C6H15NO5 — CID 89321617
2-aminohexane-1,1,3,4,6-pentol (PubChem CID 89321617) has the molecular formula C6H15NO5 and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-aminohexane-1,1,3,4,6-pentol.
| Compound Name | 2-aminohexane-1,1,3,4,6-pentol |
|---|---|
| PubChem CID | 89321617 |
| Molecular Formula | C6H15NO5 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 2-aminohexane-1,1,3,4,6-pentol |
| SMILES | NC(C(O)O)C(O)C(O)CCO |
| InChI | InChI=1S/C6H15NO5/c7-4(6(11)12)5(10)3(9)1-2-8/h3-6,8-12H,1-2,7H2 |
| InChIKey | PMZJZJICIIAMIO-UHFFFAOYSA-N |
| XLogP | -3.27 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|