C8H18O4 — CID 18506400
octane-1,3,4,5-tetrol (PubChem CID 18506400) has the molecular formula C8H18O4 and a molecular weight of 178.23 g/mol. Its IUPAC name is octane-1,3,4,5-tetrol.
| Compound Name | octane-1,3,4,5-tetrol |
|---|---|
| PubChem CID | 18506400 |
| Molecular Formula | C8H18O4 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | octane-1,3,4,5-tetrol |
| SMILES | CCCC(O)C(O)C(O)CCO |
| InChI | InChI=1S/C8H18O4/c1-2-3-6(10)8(12)7(11)4-5-9/h6-12H,2-5H2,1H3 |
| InChIKey | UPZBZCXOMZXEET-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |