C12H27NO8 — CID 171850439
6-(2,3,4,6-tetrahydroxyhexylamino)hexane-1,3,4,5-tetrol (PubChem CID 171850439) has the molecular formula C12H27NO8 and a molecular weight of 313.35 g/mol. Its IUPAC name is 6-(2,3,4,6-tetrahydroxyhexylamino)hexane-1,3,4,5-tetrol.
| Compound Name | 6-(2,3,4,6-tetrahydroxyhexylamino)hexane-1,3,4,5-tetrol |
|---|---|
| PubChem CID | 171850439 |
| Molecular Formula | C12H27NO8 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 6-(2,3,4,6-tetrahydroxyhexylamino)hexane-1,3,4,5-tetrol |
| SMILES | OCCC(O)C(O)C(O)CNCC(O)C(O)C(O)CCO |
| InChI | InChI=1S/C12H27NO8/c14-3-1-7(16)11(20)9(18)5-13-6-10(19)12(21)8(17)2-4-15/h7-21H,1-6H2 |
| InChIKey | VPFSKXYSFMZTDN-UHFFFAOYSA-N |
| XLogP | -4.49 |
| TPSA | 173.87 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | -4.49 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |