C9H19NO5 — CID 89219701
N-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]propanamide (PubChem CID 89219701) has the molecular formula C9H19NO5 and a molecular weight of 221.25 g/mol. Its IUPAC name is N-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]propanamide.
| Compound Name | N-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]propanamide |
|---|---|
| PubChem CID | 89219701 |
| Molecular Formula | C9H19NO5 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | N-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]propanamide |
| SMILES | CCC(=O)NC[C@H](O)[C@@H](O)[C@H](O)CCO |
| InChI | InChI=1S/C9H19NO5/c1-2-8(14)10-5-7(13)9(15)6(12)3-4-11/h6-7,9,11-13,15H,2-5H2,1H3,(H,10,14)/t6-,7+,9+/m1/s1 |
| InChIKey | UMAVCCWGQZNONR-FJXKBIBVSA-N |
| XLogP | -2.02 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |