C9H21NO4 — CID 156749443
(3R,4S)-6-(propan-2-ylamino)hexane-1,3,4,5-tetrol (PubChem CID 156749443) has the molecular formula C9H21NO4 and a molecular weight of 207.27 g/mol. Its IUPAC name is (3R,4S)-6-(propan-2-ylamino)hexane-1,3,4,5-tetrol.
| Compound Name | (3R,4S)-6-(propan-2-ylamino)hexane-1,3,4,5-tetrol |
|---|---|
| PubChem CID | 156749443 |
| Molecular Formula | C9H21NO4 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | (3R,4S)-6-(propan-2-ylamino)hexane-1,3,4,5-tetrol |
| SMILES | CC(C)NCC(O)[C@@H](O)[C@H](O)CCO |
| InChI | InChI=1S/C9H21NO4/c1-6(2)10-5-8(13)9(14)7(12)3-4-11/h6-14H,3-5H2,1-2H3/t7-,8?,9+/m1/s1 |
| InChIKey | VIKJXKLMXFLLTG-NBXIYJJMSA-N |
| XLogP | -1.55 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |