C12H27NO2 — CID 166863957
(2S,3R,4S,5S)-2,3,5-trimethyl-6-(propan-2-ylamino)hexane-1,4-diol (PubChem CID 166863957) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2,3,5-trimethyl-6-(propan-2-ylamino)hexane-1,4-diol.
| Compound Name | (2S,3R,4S,5S)-2,3,5-trimethyl-6-(propan-2-ylamino)hexane-1,4-diol |
|---|---|
| PubChem CID | 166863957 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | (2S,3R,4S,5S)-2,3,5-trimethyl-6-(propan-2-ylamino)hexane-1,4-diol |
| SMILES | CC(C)NC[C@H](C)[C@@H](O)[C@H](C)[C@H](C)CO |
| InChI | InChI=1S/C12H27NO2/c1-8(2)13-6-9(3)12(15)11(5)10(4)7-14/h8-15H,6-7H2,1-5H3/t9-,10+,11+,12+/m0/s1 |
| InChIKey | NGYZGVJBBBYCFH-IRCOFANPSA-N |
| XLogP | 1.25 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |