C12H23NO6 — CID 160566842
(3R)-3-ethyl-4-oxo-N-[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]pentanamide (PubChem CID 160566842) has the molecular formula C12H23NO6 and a molecular weight of 277.32 g/mol. Its IUPAC name is (3R)-3-ethyl-4-oxo-N-[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]pentanamide.
| Compound Name | (3R)-3-ethyl-4-oxo-N-[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]pentanamide |
|---|---|
| PubChem CID | 160566842 |
| Molecular Formula | C12H23NO6 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (3R)-3-ethyl-4-oxo-N-[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]pentanamide |
| SMILES | CC[C@H](CC(=O)NC[C@H](O)[C@@H](O)[C@H](O)CO)C(C)=O |
| InChI | InChI=1S/C12H23NO6/c1-3-8(7(2)15)4-11(18)13-5-9(16)12(19)10(17)6-14/h8-10,12,14,16-17,19H,3-6H2,1-2H3,(H,13,18)/t8-,9+,10-,12-/m1/s1 |
| InChIKey | GFUCLYQGHGPCAE-DTHBNOIPSA-N |
| XLogP | -1.82 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |