C13H26N2O6 — CID 157255362
(2R)-2-ethyl-N-methyl-N'-[(2S,3R,4R,5R)-2,3,4,5-tetrahydroxyhexyl]butanediamide (PubChem CID 157255362) has the molecular formula C13H26N2O6 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2R)-2-ethyl-N-methyl-N'-[(2S,3R,4R,5R)-2,3,4,5-tetrahydroxyhexyl]butanediamide.
| Compound Name | (2R)-2-ethyl-N-methyl-N'-[(2S,3R,4R,5R)-2,3,4,5-tetrahydroxyhexyl]butanediamide |
|---|---|
| PubChem CID | 157255362 |
| Molecular Formula | C13H26N2O6 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (2R)-2-ethyl-N-methyl-N'-[(2S,3R,4R,5R)-2,3,4,5-tetrahydroxyhexyl]butanediamide |
| SMILES | CCC(CC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@@H](C)O)C(=O)NC |
| InChI | InChI=1S/C13H26N2O6/c1-4-8(13(21)14-3)5-10(18)15-6-9(17)12(20)11(19)7(2)16/h7-9,11-12,16-17,19-20H,4-6H2,1-3H3,(H,14,21)(H,15,18)/t7-,8?,9+,11-,12-/m1/s1 |
| InChIKey | KSYXDKONYGXWJA-DOUGSKFGSA-N |
| XLogP | -2.27 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |