C12H25N3O7 — CID 59197821
(2S)-N-methyl-2-(methylamino)-N'-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]butanediamide (PubChem CID 59197821) has the molecular formula C12H25N3O7 and a molecular weight of 323.35 g/mol. Its IUPAC name is (2S)-N-methyl-2-(methylamino)-N'-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]butanediamide.
| Compound Name | (2S)-N-methyl-2-(methylamino)-N'-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]butanediamide |
|---|---|
| PubChem CID | 59197821 |
| Molecular Formula | C12H25N3O7 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (2S)-N-methyl-2-(methylamino)-N'-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]butanediamide |
| SMILES | CNC(=O)[C@H](CC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)NC |
| InChI | InChI=1S/C12H25N3O7/c1-13-6(12(22)14-2)3-9(19)15-4-7(17)10(20)11(21)8(18)5-16/h6-8,10-11,13,16-18,20-21H,3-5H2,1-2H3,(H,14,22)(H,15,19)/t6-,7-,8+,10+,11+/m0/s1 |
| InChIKey | VQLPIAGCEUERBE-WFADCGHZSA-N |
| XLogP | -4.74 |
| TPSA | 171.38 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -4.74 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |