C14H29NO7 — CID 171849271
ethane;5-oxo-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide (PubChem CID 171849271) has the molecular formula C14H29NO7 and a molecular weight of 323.39 g/mol. Its IUPAC name is ethane;5-oxo-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide.
| Compound Name | ethane;5-oxo-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide |
|---|---|
| PubChem CID | 171849271 |
| Molecular Formula | C14H29NO7 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | ethane;5-oxo-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide |
| SMILES | CC.CC(=O)CCCC(=O)NCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C12H23NO7.C2H6/c1-7(15)3-2-4-10(18)13-5-8(16)11(19)12(20)9(17)6-14;1-2/h8-9,11-12,14,16-17,19-20H,2-6H2,1H3,(H,13,18);1-2H3 |
| InChIKey | QXWMRUIVHJGYSC-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |