C12H24N2O6 — CID 176836986
N,2-dimethyl-N'-(2,3,4,5-tetrahydroxypentyl)pentanediamide (PubChem CID 176836986) has the molecular formula C12H24N2O6 and a molecular weight of 292.33 g/mol. Its IUPAC name is N,2-dimethyl-N'-(2,3,4,5-tetrahydroxypentyl)pentanediamide.
| Compound Name | N,2-dimethyl-N'-(2,3,4,5-tetrahydroxypentyl)pentanediamide |
|---|---|
| PubChem CID | 176836986 |
| Molecular Formula | C12H24N2O6 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N,2-dimethyl-N'-(2,3,4,5-tetrahydroxypentyl)pentanediamide |
| SMILES | CNC(=O)C(C)CCC(=O)NCC(O)C(O)C(O)CO |
| InChI | InChI=1S/C12H24N2O6/c1-7(12(20)13-2)3-4-10(18)14-5-8(16)11(19)9(17)6-15/h7-9,11,15-17,19H,3-6H2,1-2H3,(H,13,20)(H,14,18) |
| InChIKey | FZXFYZUTHMSKPU-UHFFFAOYSA-N |
| XLogP | -2.66 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |