C26H52N4O14 — CID 166658177
2-[3-[2-(tert-butylamino)ethoxy]propanoylamino]-N,N'-bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pentanediamide (PubChem CID 166658177) has the molecular formula C26H52N4O14 and a molecular weight of 644.72 g/mol. Its IUPAC name is 2-[3-[2-(tert-butylamino)ethoxy]propanoylamino]-N,N'-bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pentanediamide.
| Compound Name | 2-[3-[2-(tert-butylamino)ethoxy]propanoylamino]-N,N'-bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pentanediamide |
|---|---|
| PubChem CID | 166658177 |
| Molecular Formula | C26H52N4O14 |
| Molecular Weight | 644.72 g/mol |
| Exact Mass | 644.35 |
| IUPAC Name | 2-[3-[2-(tert-butylamino)ethoxy]propanoylamino]-N,N'-bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pentanediamide |
| SMILES | CC(C)(C)NCCOCCC(=O)NC(CCC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C26H52N4O14/c1-26(2,3)29-7-9-44-8-6-20(38)30-14(25(43)28-11-16(34)22(40)24(42)18(36)13-32)4-5-19(37)27-10-15(33)21(39)23(41)17(35)12-31/h14-18,21-24,29,31-36,39-42H,4-13H2,1-3H3,(H,27,37)(H,28,43)(H,30,38)/t14?,15-,16-,17+,18+,21+,22+,23+,24+/m0/s1 |
| InChIKey | WYOAMWKHFLEOGN-JRIUBMQXSA-N |
| XLogP | -6.85 |
| TPSA | 310.86 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.72 |
| LogP ≤ 5 | -6.85 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|