C28H53N3O9 — CID 146394062
(4S)-4-[[(2S)-2-(5,5-dimethylhexanoylamino)-3-methylbutanoyl]amino]-6,6-dimethyl-5-oxo-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]heptanamide (PubChem CID 146394062) has the molecular formula C28H53N3O9 and a molecular weight of 575.74 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-(5,5-dimethylhexanoylamino)-3-methylbutanoyl]amino]-6,6-dimethyl-5-oxo-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]heptanamide.
| Compound Name | (4S)-4-[[(2S)-2-(5,5-dimethylhexanoylamino)-3-methylbutanoyl]amino]-6,6-dimethyl-5-oxo-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]heptanamide |
|---|---|
| PubChem CID | 146394062 |
| Molecular Formula | C28H53N3O9 |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.38 |
| IUPAC Name | (4S)-4-[[(2S)-2-(5,5-dimethylhexanoylamino)-3-methylbutanoyl]amino]-6,6-dimethyl-5-oxo-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]heptanamide |
| SMILES | CC(C)[C@H](NC(=O)CCCC(C)(C)C)C(=O)N[C@@H](CCC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)C(C)(C)C |
| InChI | InChI=1S/C28H53N3O9/c1-16(2)22(31-21(36)10-9-13-27(3,4)5)26(40)30-17(25(39)28(6,7)8)11-12-20(35)29-14-18(33)23(37)24(38)19(34)15-32/h16-19,22-24,32-34,37-38H,9-15H2,1-8H3,(H,29,35)(H,30,40)(H,31,36)/t17-,18-,19+,22-,23+,24+/m0/s1 |
| InChIKey | QEMSDQUXNKYADO-HEIWLZIZSA-N |
| XLogP | -0.22 |
| TPSA | 205.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |