C28H55N3O17 — CID 177094516
(2S)-2-[3-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]propanoylamino]-N,N'-bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pentanediamide (PubChem CID 177094516) has the molecular formula C28H55N3O17 and a molecular weight of 705.75 g/mol. Its IUPAC name is (2S)-2-[3-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]propanoylamino]-N,N'-bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pentanediamide.
| Compound Name | (2S)-2-[3-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]propanoylamino]-N,N'-bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pentanediamide |
|---|---|
| PubChem CID | 177094516 |
| Molecular Formula | C28H55N3O17 |
| Molecular Weight | 705.75 g/mol |
| Exact Mass | 705.35 |
| IUPAC Name | (2S)-2-[3-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]propanoylamino]-N,N'-bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pentanediamide |
| SMILES | CCOCCOCCOCCOCCC(=O)N[C@@H](CCC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C28H55N3O17/c1-2-45-7-8-47-11-12-48-10-9-46-6-5-23(39)31-17(28(44)30-14-19(35)25(41)27(43)21(37)16-33)3-4-22(38)29-13-18(34)24(40)26(42)20(36)15-32/h17-21,24-27,32-37,40-43H,2-16H2,1H3,(H,29,38)(H,30,44)(H,31,39)/t17-,18-,19-,20+,21+,24+,25+,26+,27+/m0/s1 |
| InChIKey | ZIQHOYQJXOJPOG-WWAPHKLISA-N |
| XLogP | -7.17 |
| TPSA | 326.52 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.75 |
| LogP ≤ 5 | -7.17 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|