C23H45N3O13 — CID 91616464
(2S)-2-methyl-N-[(2R)-5-oxo-5-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pentan-2-yl]-N'-[(2R,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl]pentanediamide (PubChem CID 91616464) has the molecular formula C23H45N3O13 and a molecular weight of 571.62 g/mol. Its IUPAC name is (2S)-2-methyl-N-[(2R)-5-oxo-5-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pentan-2-yl]-N'-[(2R,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl]pentanediamide.
| Compound Name | (2S)-2-methyl-N-[(2R)-5-oxo-5-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pentan-2-yl]-N'-[(2R,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl]pentanediamide |
|---|---|
| PubChem CID | 91616464 |
| Molecular Formula | C23H45N3O13 |
| Molecular Weight | 571.62 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | (2S)-2-methyl-N-[(2R)-5-oxo-5-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pentan-2-yl]-N'-[(2R,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl]pentanediamide |
| SMILES | C[C@H](CCC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)NC(=O)[C@@H](C)CCC(=O)NC[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C23H45N3O13/c1-11(3-5-17(33)24-7-13(29)19(35)21(37)15(31)9-27)23(39)26-12(2)4-6-18(34)25-8-14(30)20(36)22(38)16(32)10-28/h11-16,19-22,27-32,35-38H,3-10H2,1-2H3,(H,24,33)(H,25,34)(H,26,39)/t11-,12+,13+,14-,15-,16+,19-,20+,21-,22+/m0/s1 |
| InChIKey | KZKZDTXHBGYASH-WRPGGODMSA-N |
| XLogP | -6.21 |
| TPSA | 289.60 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.62 |
| LogP ≤ 5 | -6.21 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 13 |