C12H23NO7 — CID 155426705
5-oxo-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]hexanamide (PubChem CID 155426705) has the molecular formula C12H23NO7 and a molecular weight of 293.32 g/mol. Its IUPAC name is 5-oxo-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]hexanamide.
| Compound Name | 5-oxo-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]hexanamide |
|---|---|
| PubChem CID | 155426705 |
| Molecular Formula | C12H23NO7 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 5-oxo-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]hexanamide |
| SMILES | CC(=O)CCCC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H23NO7/c1-7(15)3-2-4-10(18)13-5-8(16)11(19)12(20)9(17)6-14/h8-9,11-12,14,16-17,19-20H,2-6H2,1H3,(H,13,18)/t8-,9+,11+,12+/m0/s1 |
| InChIKey | JJHSJPZCSJRGRD-LUTQBAROSA-N |
| XLogP | -2.70 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |