C12H24KN2O8- — CID 172602423
potassium;carbanide;[1-carboxy-4-oxo-4-(2,3,4,5,6-pentahydroxyhexylamino)butyl]azanide (PubChem CID 172602423) has the molecular formula C12H24KN2O8- and a molecular weight of 363.43 g/mol. Its IUPAC name is potassium;carbanide;[1-carboxy-4-oxo-4-(2,3,4,5,6-pentahydroxyhexylamino)butyl]azanide.
| Compound Name | potassium;carbanide;[1-carboxy-4-oxo-4-(2,3,4,5,6-pentahydroxyhexylamino)butyl]azanide |
|---|---|
| PubChem CID | 172602423 |
| Molecular Formula | C12H24KN2O8- |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | potassium;carbanide;[1-carboxy-4-oxo-4-(2,3,4,5,6-pentahydroxyhexylamino)butyl]azanide |
| SMILES | [CH3-].[K+].[NH-]C(CCC(=O)NCC(O)C(O)C(O)C(O)CO)C(=O)O |
| InChI | InChI=1S/C11H21N2O8.CH3.K/c12-5(11(20)21)1-2-8(17)13-3-6(15)9(18)10(19)7(16)4-14;;/h5-7,9-10,12,14-16,18-19H,1-4H2,(H,13,17)(H,20,21);1H3;/q2*-1;+1 |
| InChIKey | FWWONUZUKDEZOA-UHFFFAOYSA-N |
| XLogP | -5.72 |
| TPSA | 191.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | -5.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|