C21H33N3O11 — CID 166731705
2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-5-oxo-5-(2,3,4,5,6-pentahydroxyhexylamino)pentanoic acid (PubChem CID 166731705) has the molecular formula C21H33N3O11 and a molecular weight of 503.51 g/mol. Its IUPAC name is 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-5-oxo-5-(2,3,4,5,6-pentahydroxyhexylamino)pentanoic acid.
| Compound Name | 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-5-oxo-5-(2,3,4,5,6-pentahydroxyhexylamino)pentanoic acid |
|---|---|
| PubChem CID | 166731705 |
| Molecular Formula | C21H33N3O11 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-5-oxo-5-(2,3,4,5,6-pentahydroxyhexylamino)pentanoic acid |
| SMILES | O=C(CCC(NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)O)NCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C21H33N3O11/c25-11-14(27)20(33)19(32)13(26)10-22-15(28)6-5-12(21(34)35)23-16(29)4-2-1-3-9-24-17(30)7-8-18(24)31/h7-8,12-14,19-20,25-27,32-33H,1-6,9-11H2,(H,22,28)(H,23,29)(H,34,35) |
| InChIKey | PTPFCGMFWISNHC-UHFFFAOYSA-N |
| XLogP | -3.63 |
| TPSA | 234.03 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|