C13H21N3O8 — CID 90296829
N-[(2R,3R,4R,5R)-6-aminooxy-2,3,4,5-tetrahydroxyhexyl]-3-(2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 90296829) has the molecular formula C13H21N3O8 and a molecular weight of 347.32 g/mol. Its IUPAC name is N-[(2R,3R,4R,5R)-6-aminooxy-2,3,4,5-tetrahydroxyhexyl]-3-(2,5-dioxopyrrol-1-yl)propanamide.
| Compound Name | N-[(2R,3R,4R,5R)-6-aminooxy-2,3,4,5-tetrahydroxyhexyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 90296829 |
| Molecular Formula | C13H21N3O8 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[(2R,3R,4R,5R)-6-aminooxy-2,3,4,5-tetrahydroxyhexyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | NOC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H21N3O8/c14-24-6-8(18)13(23)12(22)7(17)5-15-9(19)3-4-16-10(20)1-2-11(16)21/h1-2,7-8,12-13,17-18,22-23H,3-6,14H2,(H,15,19)/t7-,8-,12-,13-/m1/s1 |
| InChIKey | FEKVWYYUTZDVDF-QEJJIEOJSA-N |
| XLogP | -4.25 |
| TPSA | 182.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | -4.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|