C20H40N4O12 — CID 87279500
(Z)-N',N'-bis[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethyl]but-2-enediamide (PubChem CID 87279500) has the molecular formula C20H40N4O12 and a molecular weight of 528.56 g/mol. Its IUPAC name is (Z)-N',N'-bis[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethyl]but-2-enediamide.
| Compound Name | (Z)-N',N'-bis[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethyl]but-2-enediamide |
|---|---|
| PubChem CID | 87279500 |
| Molecular Formula | C20H40N4O12 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | (Z)-N',N'-bis[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethyl]but-2-enediamide |
| SMILES | NC(=O)/C=C\C(=O)N(CCNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)CCNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C20H40N4O12/c21-15(31)1-2-16(32)24(5-3-22-7-11(27)17(33)19(35)13(29)9-25)6-4-23-8-12(28)18(34)20(36)14(30)10-26/h1-2,11-14,17-20,22-23,25-30,33-36H,3-10H2,(H2,21,31)/b2-1-/t11-,12-,13+,14+,17+,18+,19+,20+/m0/s1 |
| InChIKey | GFJLWVNTDMNRJJ-OHYMUARRSA-N |
| XLogP | -8.09 |
| TPSA | 289.76 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | -8.09 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|