C13H25N3O7 — CID 87279581
(Z)-N-methyl-N'-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethyl]but-2-enediamide (PubChem CID 87279581) has the molecular formula C13H25N3O7 and a molecular weight of 335.36 g/mol. Its IUPAC name is (Z)-N-methyl-N'-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethyl]but-2-enediamide.
| Compound Name | (Z)-N-methyl-N'-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethyl]but-2-enediamide |
|---|---|
| PubChem CID | 87279581 |
| Molecular Formula | C13H25N3O7 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (Z)-N-methyl-N'-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethyl]but-2-enediamide |
| SMILES | CNC(=O)/C=C\C(=O)NCCNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H25N3O7/c1-14-10(20)2-3-11(21)16-5-4-15-6-8(18)12(22)13(23)9(19)7-17/h2-3,8-9,12-13,15,17-19,22-23H,4-7H2,1H3,(H,14,20)(H,16,21)/b3-2-/t8-,9+,12+,13+/m0/s1 |
| InChIKey | YPTMMJLAFDMVRK-YGJZQXEZSA-N |
| XLogP | -4.57 |
| TPSA | 171.38 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | -4.57 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|