C15H29NO6 — CID 18649779
N-hexyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]prop-2-enamide (PubChem CID 18649779) has the molecular formula C15H29NO6 and a molecular weight of 319.40 g/mol. Its IUPAC name is N-hexyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]prop-2-enamide.
| Compound Name | N-hexyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]prop-2-enamide |
|---|---|
| PubChem CID | 18649779 |
| Molecular Formula | C15H29NO6 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | N-hexyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CCCCCC)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C15H29NO6/c1-3-5-6-7-8-16(13(20)4-2)9-11(18)14(21)15(22)12(19)10-17/h4,11-12,14-15,17-19,21-22H,2-3,5-10H2,1H3/t11-,12+,14+,15+/m0/s1 |
| InChIKey | NMCXDEQQVUIOSI-CTHBEMJXSA-N |
| XLogP | -0.98 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|