C18H37NO7 — CID 11079412
5-hydroxy-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]dodecanamide (PubChem CID 11079412) has the molecular formula C18H37NO7 and a molecular weight of 379.49 g/mol. Its IUPAC name is 5-hydroxy-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]dodecanamide.
| Compound Name | 5-hydroxy-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]dodecanamide |
|---|---|
| PubChem CID | 11079412 |
| Molecular Formula | C18H37NO7 |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | 5-hydroxy-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]dodecanamide |
| SMILES | CCCCCCCC(O)CCCC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C18H37NO7/c1-2-3-4-5-6-8-13(21)9-7-10-16(24)19-11-14(22)17(25)18(26)15(23)12-20/h13-15,17-18,20-23,25-26H,2-12H2,1H3,(H,19,24)/t13?,14-,15+,17+,18+/m0/s1 |
| InChIKey | STZNKCFMCIZAFL-AGJUIOJISA-N |
| XLogP | -0.57 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|