C31H62N2O12 — CID 11331247
2,2-dioctyl-N,N'-bis[(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexyl]propanediamide (PubChem CID 11331247) has the molecular formula C31H62N2O12 and a molecular weight of 654.84 g/mol. Its IUPAC name is 2,2-dioctyl-N,N'-bis[(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexyl]propanediamide.
| Compound Name | 2,2-dioctyl-N,N'-bis[(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexyl]propanediamide |
|---|---|
| PubChem CID | 11331247 |
| Molecular Formula | C31H62N2O12 |
| Molecular Weight | 654.84 g/mol |
| Exact Mass | 654.43 |
| IUPAC Name | 2,2-dioctyl-N,N'-bis[(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexyl]propanediamide |
| SMILES | CCCCCCCCC(CCCCCCCC)(C(=O)NC[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)CO)C(=O)NC[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C31H62N2O12/c1-3-5-7-9-11-13-15-31(16-14-12-10-8-6-4-2,29(44)32-17-21(36)25(40)27(42)23(38)19-34)30(45)33-18-22(37)26(41)28(43)24(39)20-35/h21-28,34-43H,3-20H2,1-2H3,(H,32,44)(H,33,45)/t21-,22-,23-,24-,25+,26+,27+,28+/m1/s1 |
| InChIKey | ASRJIXYCRVQUEN-MAILWWMQSA-N |
| XLogP | -1.42 |
| TPSA | 260.50 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.84 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|