C16H33NO6 — CID 172726699
(2R)-2-hydroxy-N-methyl-2-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]undecanamide (PubChem CID 172726699) has the molecular formula C16H33NO6 and a molecular weight of 335.44 g/mol. Its IUPAC name is (2R)-2-hydroxy-N-methyl-2-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]undecanamide.
| Compound Name | (2R)-2-hydroxy-N-methyl-2-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]undecanamide |
|---|---|
| PubChem CID | 172726699 |
| Molecular Formula | C16H33NO6 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | (2R)-2-hydroxy-N-methyl-2-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]undecanamide |
| SMILES | CCCCCCCCC[C@](O)(C(=O)NC)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C16H33NO6/c1-3-4-5-6-7-8-9-10-16(23,15(22)17-2)14(21)13(20)12(19)11-18/h12-14,18-21,23H,3-11H2,1-2H3,(H,17,22)/t12-,13-,14+,16-/m1/s1 |
| InChIKey | HFYUYHJHRWSFCO-HGTKMLMNSA-N |
| XLogP | -0.32 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|