C11H21BrO6 — CID 174304395
(5S)-5-bromo-1,2,3,4,5-pentahydroxyundecan-6-one (PubChem CID 174304395) has the molecular formula C11H21BrO6 and a molecular weight of 329.19 g/mol. Its IUPAC name is (5S)-5-bromo-1,2,3,4,5-pentahydroxyundecan-6-one.
| Compound Name | (5S)-5-bromo-1,2,3,4,5-pentahydroxyundecan-6-one |
|---|---|
| PubChem CID | 174304395 |
| Molecular Formula | C11H21BrO6 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | (5S)-5-bromo-1,2,3,4,5-pentahydroxyundecan-6-one |
| SMILES | CCCCCC(=O)[C@@](O)(Br)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C11H21BrO6/c1-2-3-4-5-8(15)11(12,18)10(17)9(16)7(14)6-13/h7,9-10,13-14,16-18H,2-6H2,1H3/t7?,9?,10?,11-/m0/s1 |
| InChIKey | IDNMSFRRFGLONH-SICYWWDZSA-N |
| XLogP | -0.71 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|