C24H48O6 — CID 87516327
(10R)-10-hydroxy-10-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]icosan-9-one (PubChem CID 87516327) has the molecular formula C24H48O6 and a molecular weight of 432.64 g/mol. Its IUPAC name is (10R)-10-hydroxy-10-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]icosan-9-one.
| Compound Name | (10R)-10-hydroxy-10-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]icosan-9-one |
|---|---|
| PubChem CID | 87516327 |
| Molecular Formula | C24H48O6 |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | (10R)-10-hydroxy-10-[(1S,2R,3R)-1,2,3,4-tetrahydroxybutyl]icosan-9-one |
| SMILES | CCCCCCCCCC[C@](O)(C(=O)CCCCCCCC)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C24H48O6/c1-3-5-7-9-11-12-14-16-18-24(30,23(29)22(28)20(26)19-25)21(27)17-15-13-10-8-6-4-2/h20,22-23,25-26,28-30H,3-19H2,1-2H3/t20-,22-,23+,24+/m1/s1 |
| InChIKey | BTHQNKSHWGVBMA-AZOUXBGGSA-N |
| XLogP | 3.64 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|