C29H56O4 — CID 160625348
9-(1,2-dihydroxyethyl)-9-hydroxyheptacos-18-en-8-one (PubChem CID 160625348) has the molecular formula C29H56O4 and a molecular weight of 468.76 g/mol. Its IUPAC name is 9-(1,2-dihydroxyethyl)-9-hydroxyheptacos-18-en-8-one.
| Compound Name | 9-(1,2-dihydroxyethyl)-9-hydroxyheptacos-18-en-8-one |
|---|---|
| PubChem CID | 160625348 |
| Molecular Formula | C29H56O4 |
| Molecular Weight | 468.76 g/mol |
| Exact Mass | 468.42 |
| IUPAC Name | 9-(1,2-dihydroxyethyl)-9-hydroxyheptacos-18-en-8-one |
| SMILES | CCCCCCCCC=CCCCCCCCCC(O)(C(=O)CCCCCCC)C(O)CO |
| InChI | InChI=1S/C29H56O4/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-21-23-25-29(33,28(32)26-30)27(31)24-22-20-8-6-4-2/h13-14,28,30,32-33H,3-12,15-26H2,1-2H3 |
| InChIKey | RHFNRYPRFDIUHO-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.76 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|