C21H40O5P+ — CID 173152310
oxo-(1,2,3-trihydroxy-4-oxohenicos-12-en-3-yl)phosphanium (PubChem CID 173152310) has the molecular formula C21H40O5P+ and a molecular weight of 403.52 g/mol. Its IUPAC name is oxo-(1,2,3-trihydroxy-4-oxohenicos-12-en-3-yl)phosphanium.
| Compound Name | oxo-(1,2,3-trihydroxy-4-oxohenicos-12-en-3-yl)phosphanium |
|---|---|
| PubChem CID | 173152310 |
| Molecular Formula | C21H40O5P+ |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | oxo-(1,2,3-trihydroxy-4-oxohenicos-12-en-3-yl)phosphanium |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C(O)([PH+]=O)C(O)CO |
| InChI | InChI=1S/C21H39O5P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(23)21(25,27-26)20(24)18-22/h9-10,20,22,24-25H,2-8,11-18H2,1H3/p+1 |
| InChIKey | OHOZXHFDTMAXLO-UHFFFAOYSA-O |
| XLogP | 4.66 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|