C29H54O5 — CID 173393318
11,12-dihydroxy-11-(hydroxymethyl)octacos-21-ene-10,13-dione (PubChem CID 173393318) has the molecular formula C29H54O5 and a molecular weight of 482.75 g/mol. Its IUPAC name is 11,12-dihydroxy-11-(hydroxymethyl)octacos-21-ene-10,13-dione.
| Compound Name | 11,12-dihydroxy-11-(hydroxymethyl)octacos-21-ene-10,13-dione |
|---|---|
| PubChem CID | 173393318 |
| Molecular Formula | C29H54O5 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.40 |
| IUPAC Name | 11,12-dihydroxy-11-(hydroxymethyl)octacos-21-ene-10,13-dione |
| SMILES | CCCCCCC=CCCCCCCCC(=O)C(O)C(O)(CO)C(=O)CCCCCCCCC |
| InChI | InChI=1S/C29H54O5/c1-3-5-7-9-11-12-13-14-15-16-18-19-21-23-26(31)28(33)29(34,25-30)27(32)24-22-20-17-10-8-6-4-2/h12-13,28,30,33-34H,3-11,14-25H2,1-2H3 |
| InChIKey | UBXUSXPJHDYTOT-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|