C27H50O5 — CID 173284622
7,8-dihydroxy-8-(hydroxymethyl)hexacos-17-ene-6,9-dione (PubChem CID 173284622) has the molecular formula C27H50O5 and a molecular weight of 454.69 g/mol. Its IUPAC name is 7,8-dihydroxy-8-(hydroxymethyl)hexacos-17-ene-6,9-dione.
| Compound Name | 7,8-dihydroxy-8-(hydroxymethyl)hexacos-17-ene-6,9-dione |
|---|---|
| PubChem CID | 173284622 |
| Molecular Formula | C27H50O5 |
| Molecular Weight | 454.69 g/mol |
| Exact Mass | 454.37 |
| IUPAC Name | 7,8-dihydroxy-8-(hydroxymethyl)hexacos-17-ene-6,9-dione |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C(O)(CO)C(O)C(=O)CCCCC |
| InChI | InChI=1S/C27H50O5/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-20-22-25(30)27(32,23-28)26(31)24(29)21-19-6-4-2/h12-13,26,28,31-32H,3-11,14-23H2,1-2H3 |
| InChIKey | BETGLRIVAJMIBS-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.69 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|