C44H84NO5+ — CID 87205328
2-[(9Z,29Z)-20-hydroxy-20-(hydroxymethyl)-18,21-dioxooctatriaconta-9,29-dien-19-yl]oxyethyl-trimethylazanium (PubChem CID 87205328) has the molecular formula C44H84NO5+ and a molecular weight of 707.16 g/mol. Its IUPAC name is 2-[(9Z,29Z)-20-hydroxy-20-(hydroxymethyl)-18,21-dioxooctatriaconta-9,29-dien-19-yl]oxyethyl-trimethylazanium.
| Compound Name | 2-[(9Z,29Z)-20-hydroxy-20-(hydroxymethyl)-18,21-dioxooctatriaconta-9,29-dien-19-yl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 87205328 |
| Molecular Formula | C44H84NO5+ |
| Molecular Weight | 707.16 g/mol |
| Exact Mass | 706.63 |
| IUPAC Name | 2-[(9Z,29Z)-20-hydroxy-20-(hydroxymethyl)-18,21-dioxooctatriaconta-9,29-dien-19-yl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(OCC[N+](C)(C)C)C(O)(CO)C(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C44H84NO5/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-41(47)43(50-39-38-45(3,4)5)44(49,40-46)42(48)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h20-23,43,46,49H,6-19,24-40H2,1-5H3/q+1/b22-20-,23-21- |
| InChIKey | XIXNOMVFEZHDNQ-YEUCEMRASA-N |
| XLogP | 11.01 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.16 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|