C31H54O5 — CID 87472819
(15E,18E,21E)-9,10-dihydroxy-10-(hydroxymethyl)triaconta-15,18,21-triene-8,11-dione (PubChem CID 87472819) has the molecular formula C31H54O5 and a molecular weight of 506.77 g/mol. Its IUPAC name is (15E,18E,21E)-9,10-dihydroxy-10-(hydroxymethyl)triaconta-15,18,21-triene-8,11-dione.
| Compound Name | (15E,18E,21E)-9,10-dihydroxy-10-(hydroxymethyl)triaconta-15,18,21-triene-8,11-dione |
|---|---|
| PubChem CID | 87472819 |
| Molecular Formula | C31H54O5 |
| Molecular Weight | 506.77 g/mol |
| Exact Mass | 506.40 |
| IUPAC Name | (15E,18E,21E)-9,10-dihydroxy-10-(hydroxymethyl)triaconta-15,18,21-triene-8,11-dione |
| SMILES | CCCCCCCC/C=C/C/C=C/C/C=C/CCCC(=O)C(O)(CO)C(O)C(=O)CCCCCCC |
| InChI | InChI=1S/C31H54O5/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-22-24-26-29(34)31(36,27-32)30(35)28(33)25-23-21-8-6-4-2/h13-14,16-17,19-20,30,32,35-36H,3-12,15,18,21-27H2,1-2H3/b14-13+,17-16+,20-19+ |
| InChIKey | CSECAQRWXFMDMW-NFDRKHFSSA-N |
| XLogP | 6.94 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.77 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|