C13H24O5 — CID 18920785
5,6-dihydroxy-5-(hydroxymethyl)dodecane-4,7-dione (PubChem CID 18920785) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is 5,6-dihydroxy-5-(hydroxymethyl)dodecane-4,7-dione.
| Compound Name | 5,6-dihydroxy-5-(hydroxymethyl)dodecane-4,7-dione |
|---|---|
| PubChem CID | 18920785 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 5,6-dihydroxy-5-(hydroxymethyl)dodecane-4,7-dione |
| SMILES | CCCCCC(=O)C(O)C(O)(CO)C(=O)CCC |
| InChI | InChI=1S/C13H24O5/c1-3-5-6-8-10(15)12(17)13(18,9-14)11(16)7-4-2/h12,14,17-18H,3-9H2,1-2H3 |
| InChIKey | KMEFHIAHNMKHIO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|