C10H18O5 — CID 18920774
2,3-dihydroxy-2-(hydroxymethyl)-4-oxononanal (PubChem CID 18920774) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is 2,3-dihydroxy-2-(hydroxymethyl)-4-oxononanal.
| Compound Name | 2,3-dihydroxy-2-(hydroxymethyl)-4-oxononanal |
|---|---|
| PubChem CID | 18920774 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2,3-dihydroxy-2-(hydroxymethyl)-4-oxononanal |
| SMILES | CCCCCC(=O)C(O)C(O)(C=O)CO |
| InChI | InChI=1S/C10H18O5/c1-2-3-4-5-8(13)9(14)10(15,6-11)7-12/h6,9,12,14-15H,2-5,7H2,1H3 |
| InChIKey | GOTGFTYLCQQFKB-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|