C15H28O5 — CID 21462249
7,8-dihydroxy-7-(hydroxymethyl)tetradecane-6,9-dione (PubChem CID 21462249) has the molecular formula C15H28O5 and a molecular weight of 288.38 g/mol. Its IUPAC name is 7,8-dihydroxy-7-(hydroxymethyl)tetradecane-6,9-dione.
| Compound Name | 7,8-dihydroxy-7-(hydroxymethyl)tetradecane-6,9-dione |
|---|---|
| PubChem CID | 21462249 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 7,8-dihydroxy-7-(hydroxymethyl)tetradecane-6,9-dione |
| SMILES | CCCCCC(=O)C(O)C(O)(CO)C(=O)CCCCC |
| InChI | InChI=1S/C15H28O5/c1-3-5-7-9-12(17)14(19)15(20,11-16)13(18)10-8-6-4-2/h14,16,19-20H,3-11H2,1-2H3 |
| InChIKey | CPPRHJDIPKVMKA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|