C44H87NO9P+ — CID 173499910
19-(1,2-dihydroxyethyl)-19-hydroxyheptatriaconta-9,28-diene-18,20-dione;trimethyl(2-phosphonooxyethyl)azanium (PubChem CID 173499910) has the molecular formula C44H87NO9P+ and a molecular weight of 805.15 g/mol. Its IUPAC name is 19-(1,2-dihydroxyethyl)-19-hydroxyheptatriaconta-9,28-diene-18,20-dione;trimethyl(2-phosphonooxyethyl)azanium.
| Compound Name | 19-(1,2-dihydroxyethyl)-19-hydroxyheptatriaconta-9,28-diene-18,20-dione;trimethyl(2-phosphonooxyethyl)azanium |
|---|---|
| PubChem CID | 173499910 |
| Molecular Formula | C44H87NO9P+ |
| Molecular Weight | 805.15 g/mol |
| Exact Mass | 804.61 |
| IUPAC Name | 19-(1,2-dihydroxyethyl)-19-hydroxyheptatriaconta-9,28-diene-18,20-dione;trimethyl(2-phosphonooxyethyl)azanium |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C(O)(C(=O)CCCCCCCC=CCCCCCCCC)C(O)CO.C[N+](C)(C)CCOP(=O)(O)O |
| InChI | InChI=1S/C39H72O5.C5H14NO4P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36(41)39(44,38(43)35-40)37(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;1-6(2,3)4-5-10-11(7,8)9/h17-20,38,40,43-44H,3-16,21-35H2,1-2H3;4-5H2,1-3H3,(H-,7,8,9)/p+1 |
| InChIKey | USQGBGJIJRDWJN-UHFFFAOYSA-O |
| XLogP | 10.09 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.15 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|