C45H64NO8P — CID 69116643
(2S,3S,9Z,12Z,15Z)-1,2,3-trihydroxy-3-tritylhenicosa-9,12,15-trien-4-one;2-(trimethylazaniumyl)ethyl hydrogen phosphate (PubChem CID 69116643) has the molecular formula C45H64NO8P and a molecular weight of 777.98 g/mol. Its IUPAC name is (2S,3S,9Z,12Z,15Z)-1,2,3-trihydroxy-3-tritylhenicosa-9,12,15-trien-4-one;2-(trimethylazaniumyl)ethyl hydrogen phosphate.
| Compound Name | (2S,3S,9Z,12Z,15Z)-1,2,3-trihydroxy-3-tritylhenicosa-9,12,15-trien-4-one;2-(trimethylazaniumyl)ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 69116643 |
| Molecular Formula | C45H64NO8P |
| Molecular Weight | 777.98 g/mol |
| Exact Mass | 777.44 |
| IUPAC Name | (2S,3S,9Z,12Z,15Z)-1,2,3-trihydroxy-3-tritylhenicosa-9,12,15-trien-4-one;2-(trimethylazaniumyl)ethyl hydrogen phosphate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)[C@@](O)([C@@H](O)CO)C(c1ccccc1)(c1ccccc1)c1ccccc1.C[N+](C)(C)CCOP(=O)([O-])O |
| InChI | InChI=1S/C40H50O4.C5H14NO4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-25-32-37(42)40(44,38(43)33-41)39(34-26-19-16-20-27-34,35-28-21-17-22-29-35)36-30-23-18-24-31-36;1-6(2,3)4-5-10-11(7,8)9/h6-7,9-10,12-13,16-24,26-31,38,41,43-44H,2-5,8,11,14-15,25,32-33H2,1H3;4-5H2,1-3H3,(H-,7,8,9)/b7-6-,10-9-,13-12-;/t38-,40+;/m0./s1 |
| InChIKey | FATADBUPHBRFNK-QCJPKSGLSA-N |
| XLogP | 7.43 |
| TPSA | 147.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.98 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|