C19H36O5 — CID 22880298
9-[(1S)-1,2-dihydroxyethyl]-9-hydroxyheptadecane-8,10-dione (PubChem CID 22880298) has the molecular formula C19H36O5 and a molecular weight of 344.49 g/mol. Its IUPAC name is 9-[(1S)-1,2-dihydroxyethyl]-9-hydroxyheptadecane-8,10-dione.
| Compound Name | 9-[(1S)-1,2-dihydroxyethyl]-9-hydroxyheptadecane-8,10-dione |
|---|---|
| PubChem CID | 22880298 |
| Molecular Formula | C19H36O5 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | 9-[(1S)-1,2-dihydroxyethyl]-9-hydroxyheptadecane-8,10-dione |
| SMILES | CCCCCCCC(=O)C(O)(C(=O)CCCCCCC)[C@@H](O)CO |
| InChI | InChI=1S/C19H36O5/c1-3-5-7-9-11-13-16(21)19(24,18(23)15-20)17(22)14-12-10-8-6-4-2/h18,20,23-24H,3-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | WDXLNFWKDPIHOW-SFHVURJKSA-N |
| XLogP | 2.93 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|