C23H42O5 — CID 173393315
11-(1,2-dihydroxyethyl)-11-hydroxyhenicos-8-ene-10,12-dione (PubChem CID 173393315) has the molecular formula C23H42O5 and a molecular weight of 398.58 g/mol. Its IUPAC name is 11-(1,2-dihydroxyethyl)-11-hydroxyhenicos-8-ene-10,12-dione.
| Compound Name | 11-(1,2-dihydroxyethyl)-11-hydroxyhenicos-8-ene-10,12-dione |
|---|---|
| PubChem CID | 173393315 |
| Molecular Formula | C23H42O5 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | 11-(1,2-dihydroxyethyl)-11-hydroxyhenicos-8-ene-10,12-dione |
| SMILES | CCCCCCCC=CC(=O)C(O)(C(=O)CCCCCCCCC)C(O)CO |
| InChI | InChI=1S/C23H42O5/c1-3-5-7-9-11-13-15-17-20(25)23(28,22(27)19-24)21(26)18-16-14-12-10-8-6-4-2/h15,17,22,24,27-28H,3-14,16,18-19H2,1-2H3 |
| InChIKey | JZYSDXPMCJMULA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|