C44H89NO6P+ — CID 123741852
2-[19-(1,2-dihydroxyethyl)heptatriaconta-9,28-dien-19-yloxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 123741852) has the molecular formula C44H89NO6P+ and a molecular weight of 759.17 g/mol. Its IUPAC name is 2-[19-(1,2-dihydroxyethyl)heptatriaconta-9,28-dien-19-yloxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[19-(1,2-dihydroxyethyl)heptatriaconta-9,28-dien-19-yloxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 123741852 |
| Molecular Formula | C44H89NO6P+ |
| Molecular Weight | 759.17 g/mol |
| Exact Mass | 758.64 |
| IUPAC Name | 2-[19-(1,2-dihydroxyethyl)heptatriaconta-9,28-dien-19-yloxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCCC=CCCCCCCCCC(CCCCCCCCC=CCCCCCCCC)(OP(=O)(O)OCC[N+](C)(C)C)C(O)CO |
| InChI | InChI=1S/C44H88NO6P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-44(43(47)42-46,51-52(48,49)50-41-40-45(3,4)5)39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h20-23,43,46-47H,6-19,24-42H2,1-5H3/p+1 |
| InChIKey | ALHAJKGTJMDUTI-UHFFFAOYSA-O |
| XLogP | 12.77 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.17 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|