C29H61NO5P+ — CID 88613599
[5-hydroxy-4-[hydroxy-[(Z)-3-hydroxyhenicos-12-en-3-yl]oxyphosphoryl]pentyl]-trimethylazanium (PubChem CID 88613599) has the molecular formula C29H61NO5P+ and a molecular weight of 534.78 g/mol. Its IUPAC name is [5-hydroxy-4-[hydroxy-[(Z)-3-hydroxyhenicos-12-en-3-yl]oxyphosphoryl]pentyl]-trimethylazanium.
| Compound Name | [5-hydroxy-4-[hydroxy-[(Z)-3-hydroxyhenicos-12-en-3-yl]oxyphosphoryl]pentyl]-trimethylazanium |
|---|---|
| PubChem CID | 88613599 |
| Molecular Formula | C29H61NO5P+ |
| Molecular Weight | 534.78 g/mol |
| Exact Mass | 534.43 |
| IUPAC Name | [5-hydroxy-4-[hydroxy-[(Z)-3-hydroxyhenicos-12-en-3-yl]oxyphosphoryl]pentyl]-trimethylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(O)(CC)OP(=O)(O)C(CO)CCC[N+](C)(C)C |
| InChI | InChI=1S/C29H60NO5P/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25-29(32,7-2)35-36(33,34)28(27-31)24-23-26-30(3,4)5/h14-15,28,31-32H,6-13,16-27H2,1-5H3/p+1/b15-14- |
| InChIKey | JTMGNPPDBVGLSV-PFONDFGASA-O |
| XLogP | 7.56 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.78 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|