C27H55NO4P+ — CID 87061849
[(9Z,18Z)-2-hydroxy-2-phosphonotetracosa-9,18-dienyl]-trimethylazanium (PubChem CID 87061849) has the molecular formula C27H55NO4P+ and a molecular weight of 488.71 g/mol. Its IUPAC name is [(9Z,18Z)-2-hydroxy-2-phosphonotetracosa-9,18-dienyl]-trimethylazanium.
| Compound Name | [(9Z,18Z)-2-hydroxy-2-phosphonotetracosa-9,18-dienyl]-trimethylazanium |
|---|---|
| PubChem CID | 87061849 |
| Molecular Formula | C27H55NO4P+ |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.39 |
| IUPAC Name | [(9Z,18Z)-2-hydroxy-2-phosphonotetracosa-9,18-dienyl]-trimethylazanium |
| SMILES | CCCCC/C=C\CCCCCCC/C=C\CCCCCCC(O)(C[N+](C)(C)C)P(=O)(O)O |
| InChI | InChI=1S/C27H54NO4P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-27(29,33(30,31)32)26-28(2,3)4/h9-10,18-19,29H,5-8,11-17,20-26H2,1-4H3,(H-,30,31,32)/p+1/b10-9-,19-18- |
| InChIKey | ACEPGKXWTYDUTL-DEXHTJMYSA-O |
| XLogP | 7.32 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|