C28H57NO4P+ — CID 87062858
[(7Z,18Z)-2-hydroxy-2-phosphonopentacosa-7,18-dienyl]-trimethylazanium (PubChem CID 87062858) has the molecular formula C28H57NO4P+ and a molecular weight of 502.74 g/mol. Its IUPAC name is [(7Z,18Z)-2-hydroxy-2-phosphonopentacosa-7,18-dienyl]-trimethylazanium.
| Compound Name | [(7Z,18Z)-2-hydroxy-2-phosphonopentacosa-7,18-dienyl]-trimethylazanium |
|---|---|
| PubChem CID | 87062858 |
| Molecular Formula | C28H57NO4P+ |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.40 |
| IUPAC Name | [(7Z,18Z)-2-hydroxy-2-phosphonopentacosa-7,18-dienyl]-trimethylazanium |
| SMILES | CCCCCC/C=C\CCCCCCCCC/C=C\CCCCC(O)(C[N+](C)(C)C)P(=O)(O)O |
| InChI | InChI=1S/C28H56NO4P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-28(30,34(31,32)33)27-29(2,3)4/h10-11,21-22,30H,5-9,12-20,23-27H2,1-4H3,(H-,31,32,33)/p+1/b11-10-,22-21- |
| InChIKey | PIDQMIRQAFJGFA-XNFVHRLYSA-O |
| XLogP | 7.71 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|