C25H52O3 — CID 87647461
4,4-dihexyltridecane-1,2,3-triol (PubChem CID 87647461) has the molecular formula C25H52O3 and a molecular weight of 400.69 g/mol. Its IUPAC name is 4,4-dihexyltridecane-1,2,3-triol.
| Compound Name | 4,4-dihexyltridecane-1,2,3-triol |
|---|---|
| PubChem CID | 87647461 |
| Molecular Formula | C25H52O3 |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 400.39 |
| IUPAC Name | 4,4-dihexyltridecane-1,2,3-triol |
| SMILES | CCCCCCCCCC(CCCCCC)(CCCCCC)C(O)C(O)CO |
| InChI | InChI=1S/C25H52O3/c1-4-7-10-13-14-15-18-21-25(19-16-11-8-5-2,20-17-12-9-6-3)24(28)23(27)22-26/h23-24,26-28H,4-22H2,1-3H3 |
| InChIKey | VOMXYYSUFNFGEJ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|