C13H27NO6 — CID 155358754
4,4-dimethyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pentanamide (PubChem CID 155358754) has the molecular formula C13H27NO6 and a molecular weight of 293.36 g/mol. Its IUPAC name is 4,4-dimethyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pentanamide.
| Compound Name | 4,4-dimethyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pentanamide |
|---|---|
| PubChem CID | 155358754 |
| Molecular Formula | C13H27NO6 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 4,4-dimethyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pentanamide |
| SMILES | CC(C)(C)CCC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H27NO6/c1-13(2,3)5-4-10(18)14-6-8(16)11(19)12(20)9(17)7-15/h8-9,11-12,15-17,19-20H,4-7H2,1-3H3,(H,14,18)/t8-,9+,11+,12+/m0/s1 |
| InChIKey | ARCAYJXPIPDSMS-LUTQBAROSA-N |
| XLogP | -1.64 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |