C6H14O4 — CID 123357506
2-(hydroxymethyl)pentane-1,3,5-triol (PubChem CID 123357506) has the molecular formula C6H14O4 and a molecular weight of 150.17 g/mol. Its IUPAC name is 2-(hydroxymethyl)pentane-1,3,5-triol.
| Compound Name | 2-(hydroxymethyl)pentane-1,3,5-triol |
|---|---|
| PubChem CID | 123357506 |
| Molecular Formula | C6H14O4 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 2-(hydroxymethyl)pentane-1,3,5-triol |
| SMILES | OCCC(O)C(CO)CO |
| InChI | InChI=1S/C6H14O4/c7-2-1-6(10)5(3-8)4-9/h5-10H,1-4H2 |
| InChIKey | PGEFSUHGUTWIFW-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |