C8H18O6 — CID 90970017
3-(1,2-dihydroxyethyl)hexane-1,2,4,6-tetrol (PubChem CID 90970017) has the molecular formula C8H18O6 and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-(1,2-dihydroxyethyl)hexane-1,2,4,6-tetrol.
| Compound Name | 3-(1,2-dihydroxyethyl)hexane-1,2,4,6-tetrol |
|---|---|
| PubChem CID | 90970017 |
| Molecular Formula | C8H18O6 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 3-(1,2-dihydroxyethyl)hexane-1,2,4,6-tetrol |
| SMILES | OCCC(O)C(C(O)CO)C(O)CO |
| InChI | InChI=1S/C8H18O6/c9-2-1-5(12)8(6(13)3-10)7(14)4-11/h5-14H,1-4H2 |
| InChIKey | ZGCLIBRCFJZGKL-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |