C11H24O6 — CID 90765548
5-(1,2-dihydroxyethyl)nonane-1,4,6,8-tetrol (PubChem CID 90765548) has the molecular formula C11H24O6 and a molecular weight of 252.31 g/mol. Its IUPAC name is 5-(1,2-dihydroxyethyl)nonane-1,4,6,8-tetrol.
| Compound Name | 5-(1,2-dihydroxyethyl)nonane-1,4,6,8-tetrol |
|---|---|
| PubChem CID | 90765548 |
| Molecular Formula | C11H24O6 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 5-(1,2-dihydroxyethyl)nonane-1,4,6,8-tetrol |
| SMILES | CC(O)CC(O)C(C(O)CO)C(O)CCCO |
| InChI | InChI=1S/C11H24O6/c1-7(14)5-9(16)11(10(17)6-13)8(15)3-2-4-12/h7-17H,2-6H2,1H3 |
| InChIKey | DEFAJSLBEHTKQS-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |