C13H32O4 — CID 174469450
ethane-1,2-diol;2-ethylhexane-1,3-diol;propane (PubChem CID 174469450) has the molecular formula C13H32O4 and a molecular weight of 252.39 g/mol. Its IUPAC name is ethane-1,2-diol;2-ethylhexane-1,3-diol;propane.
| Compound Name | ethane-1,2-diol;2-ethylhexane-1,3-diol;propane |
|---|---|
| PubChem CID | 174469450 |
| Molecular Formula | C13H32O4 |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | ethane-1,2-diol;2-ethylhexane-1,3-diol;propane |
| SMILES | CCC.CCCC(O)C(CC)CO.OCCO |
| InChI | InChI=1S/C8H18O2.C3H8.C2H6O2/c1-3-5-8(10)7(4-2)6-9;1-3-2;3-1-2-4/h7-10H,3-6H2,1-2H3;3H2,1-2H3;3-4H,1-2H2 |
| InChIKey | FNRQVGHJJGMLSY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |